T7691130
Altrenogest , >98.0%(HPLC) , 850-52-2
Synonym(s):
17-α-Allyl-17-β-hydroxyoestra-4,9,11-trien-3-one;Allyltrenbolone;Regumate
CAS NO.：850-52-2
Empirical Formula: C21H26O2
Molecular Weight: 310.44
MDL number: MFCD00867855
EINECS: 212-703-1
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB236.00 | In Stock |
|
| 1g | RMB796.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120° |
| alpha | D20 -72° (c = 0.5 in ethanol) |
| Boiling point: | 390.58°C (rough estimate) |
| Density | 1.0865 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 2 mg/ml; DMSO: 0.1 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml |
| pka | 14.59±0.40(Predicted) |
| form | Solid |
| color | White to Yellow |
| Merck | 14,319 |
| InChI | InChI=1/C21H26O2/c1-3-10-21(23)12-9-19-18-6-4-14-13-15(22)5-7-16(14)17(18)8-11-20(19,21)2/h3,8,11,13,18-19,23H,1,4-7,9-10,12H2,2H3/t18-,19+,20+,21+/s3 |
| InChIKey | VWAUPFMBXBWEQY-ANULTFPQSA-N |
| SMILES | C[C@]12C=CC3=C4CCC(=O)C=C4CC[C@@]3([H])[C@]1([H])CC[C@@]2(O)CC=C |&1:1,14,16,20,r| |
Description and Uses
Altrenogest can be used as a synthetic progestational agent used in veterinary medicine for the control of estrus in mares and antineoplastic.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H360FD-H373-H410 |
| Precautionary statements | P202-P260-P264-P270-P273-P301+P310 |
| WGK Germany | 3 |
| RTECS | KG7745000 |
| HS Code | 2937.23.5050 |
