T7695930
3-Amino-5-(4-methoxyphenyl)pyrazole , >98.0%(T)(HPLC) , 19541-95-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145°C |
| Boiling point: | 466.4±40.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.88±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H11N3O/c1-14-8-4-2-7(3-5-8)9-6-10(11)13-12-9/h2-6H,1H3,(H3,11,12,13) |
| InChIKey | UPAGEJODHNVJNM-UHFFFAOYSA-N |
| SMILES | N1C(C2=CC=C(OC)C=C2)=CC(N)=N1 |
| CAS DataBase Reference | 19541-95-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






