T7738230
INT Formazan , 7781-49-9
Synonym(s):
1-(4-Iodophenyl)-5-(4-nitrophenyl)-3-phenylformazan;INT-Formazan;Iodonitrotetrazolium formazan
CAS NO.:7781-49-9
Empirical Formula: C19H14IN5O2
Molecular Weight: 471.25
MDL number: MFCD00007300
EINECS: 231-950-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187 °C (dec.)(lit.) |
| Boiling point: | 564.9±60.0 °C(Predicted) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 50mg/mL |
| form | crystalline |
| pka | 9.53±0.10(Predicted) |
| color | brown |
| BRN | 1829738 |
| InChI | 1S/C19H14IN5O2/c20-15-6-8-16(9-7-15)21-23-19(14-4-2-1-3-5-14)24-22-17-10-12-18(13-11-17)25(26)27/h1-13,22H/b23-21,24-19- |
| InChIKey | FVFWUNAWQMROIF-CDNKMLFNSA-N |
| SMILES | [O-][N+](=O)c1ccc(NN=C(N=Nc2ccc(I)cc2)c3ccccc3)cc1 |
Description and Uses
- Starvation-survival processes of a marine Vibrio.: This research explores the use of Iodonitrotetrazolium Violet-Formazan for studying the starvation-survival mechanisms in marine Vibrio, highlighting its application as a metabolic activity indicator under nutrient-deprived conditions, which is crucial for understanding bacterial survival strategies in natural aquatic environments (Amy et al., 1983).
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H334 |
| Precautionary statements | P261-P342+P311 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 22-24/25-36/37 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 2928.00.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 |






