PRODUCT Properties
| Melting point: | 138-140 °C(lit.) |
| Boiling point: | 248.79°C (rough estimate) |
| Density | 1.2686 (rough estimate) |
| refractive index | 1.6411 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Almost white |
| BRN | 4655839 |
| InChI | 1S/C10H15Br/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2/t6-,7+,8-,9+,10? |
| InChIKey | RCXJARRRXOPXBC-MGPGSJOLSA-N |
| SMILES | BrC1[C@H]2C[C@@H]3C[C@H](C2)C[C@H]1C3 |
| CAS DataBase Reference | 7314-85-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Tricyclo[3.3.1.13,7]decane, 2-bromo-(7314-85-4) |
Description and Uses
2-Bromoadamantane was used to study the c-alkylation of phenol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29038900 |
| Storage Class | 11 - Combustible Solids |





