PRODUCT Properties
| Melting point: | -34 °C |
| Boiling point: | 217 °C / 11mmHg |
| Density | 1.00 |
| vapor pressure | 0.006Pa at 25℃ |
| refractive index | n20/D 1.444(lit.) |
| Flash point: | 199 °C |
| solubility | Insoluble in water |
| solubility | Insoluble[in water] |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | 101mg/L at 20℃ |
| InChI | InChI=1S/C18H34O6/c1-3-5-11-21-13-15-23-17(19)9-7-8-10-18(20)24-16-14-22-12-6-4-2/h3-16H2,1-2H3 |
| InChIKey | IHTSDBYPAZEUOP-UHFFFAOYSA-N |
| SMILES | C(OCCOCCCC)(=O)CCCCC(OCCOCCCC)=O |
| LogP | 3.78 |
| CAS DataBase Reference | 141-18-4 |
| EPA Substance Registry System | Hexanedioic acid, bis(2-butoxyethyl) ester (141-18-4) |
Description and Uses
Dibutoxyethyl adipate is used as a plasticizer for polyvinyl chloride and polyvinyl chloride–acetate copolymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| RTECS | AU8450000 |
| TSCA | TSCA listed |
| HS Code | 2917.12.5000 |
| Toxicity | LD50 ipr-rat: 600 mg/kg 14CYAT 2,1882,63 |






