T8040230
2-Bromotetrafluoroethyl Trifluorovinyl Ether (stabilized with MEHQ) , >98.0%(GC) , 85737-06-0
CAS NO.：85737-06-0
Empirical Formula: C4BrF7O
Molecular Weight: 276.93
MDL number: MFCD02183517
EINECS: 288-516-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 55 °C |
| Density | 1.902±0.06 g/cm3(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C4BrF7O/c5-3(9,10)4(11,12)13-2(8)1(6)7 |
| InChIKey | ZPYGRBTUNITHKJ-UHFFFAOYSA-N |
| SMILES | C(/OC(F)(F)C(Br)(F)F)(\F)=C(\F)/F |
| CAS DataBase Reference | 85737-06-0(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluoro(2-bromoethoxy)ethene (85737-06-0) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2909199090 |
