T8294130
4-Chloro-6-nitro-m-cresol , >98.0%(GC) , 7147-89-9
Synonym(s):
4-Chloro-6-nitro-m-cresol
CAS NO.：7147-89-9
Empirical Formula: C7H6ClNO3
Molecular Weight: 187.58
MDL number: MFCD00007114
EINECS: 230-461-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB632.00 | In Stock |
|
| 25g | RMB2480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-134 °C(lit.) |
| Boiling point: | 276.7±35.0 °C(Predicted) |
| Density | 1.4219 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | RT, stored under nitrogen |
| pka | 6.51±0.27(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| InChI | 1S/C7H6ClNO3/c1-4-2-7(10)6(9(11)12)3-5(4)8/h2-3,10H,1H3 |
| InChIKey | JBMGJOKJUYGIJH-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 7147-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4-chloro-5-methyl-2-nitro- (7147-89-9) |
Description and Uses
4-Chloro-3-methyl-6-nitrophenol was used to evaluate toxicity in Tetrahymena pyriformis by quantitative structure-toxicity relationships-topological substructural molecular design method.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
