T8332030
Coumarin 102 , >97.0%(HPLC)(N) , 41267-76-9
Synonym(s):
2,3,6,7-Tetrahydro-9-methyl-1H,5H-quinolizino(9,1-gh)coumarin;8-Methyl-2,3,5,6-tetrahydro-1H,4H-11-oxa-3a-aza-benzo(de)anthracen-10-one;Coumarin 480
CAS NO.:41267-76-9
Empirical Formula: C16H17NO2
Molecular Weight: 255.31
MDL number: MFCD00041844
EINECS: 255-285-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1308.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-156 °C (lit.) |
| Boiling point: | 398.54°C (rough estimate) |
| Density | 1.0699 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C, protect from light |
| pka | 5?+-.0.40(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Appearance | Yellow Needle-like Crystals |
| λmax | 390 nm (lit.) 390 nm |
| BRN | 4818243 |
| InChI | 1S/C16H17NO2/c1-10-8-14(18)19-16-12-5-3-7-17-6-2-4-11(15(12)17)9-13(10)16/h8-9H,2-7H2,1H3 |
| InChIKey | XHXMPURWMSJENN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)Oc2c3CCCN4CCCc(cc12)c34 |
| EPA Substance Registry System | 1H,5H,11H-[1]Benzopyrano[6,7,8-ij]quinolizin-11-one, 2,3,6,7-tetrahydro-9-methyl- (41267-76-9) |
Description and Uses
Coumarin 480 is a fluorescent probe used in the study of solvent relaxation dynamics. Coumarin 480 can be used as a laser dye.
Laser dye.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H302-H312-H319-H332 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P261-P271-P304+P340-P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| RTECS | DJ3320000 |
| TSCA | TSCA listed |
| HS Code | 29322010 |
| Storage Class | 11 - Combustible Solids |






