PRODUCT Properties
| Melting point: | 50-52 °C (lit.) |
| Boiling point: | 93°C/1.8mmHg(lit.) |
| Density | 0.877 g/mL at 25 °C |
| Flash point: | 87 °F |
| form | powder to lump |
| color | White to Almost white |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | 1S/C9H27ClSi4/c1-11(2,3)14(10,12(4,5)6)13(7,8)9/h1-9H3 |
| InChIKey | HCOROOJWVHFMRJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](Cl)([Si](C)(C)C)[Si](C)(C)C |
Description and Uses
Super Silyl Protecting Groups
Used for:
- Insertion into a P-P bond
- Diastereoselective aldol and cascade reactions
- Preparation of hypersilyl substituted monophosphines and diphosphines
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H261-H315-H319-H335 |
| Precautionary statements | P210-P231+P232-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C,Xn,Xi |
| Risk Statements | 11-29-34-67-65-48/20-36/37/38-63 |
| Safety Statements | 16-26-36/37/39-43-45-7/8-62-36/37-Neverusewater. |
| RIDADR | UN 2925 4.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931.90.9010 |
| HazardClass | 4.1/8 |
| PackingGroup | II |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 Water-react 3 |
