T8380030
4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidine , >98.0%(GC)(T) , 21928-50-7
CAS NO.:21928-50-7
Empirical Formula: C12H13ClF3NO
Molecular Weight: 279.69
MDL number: MFCD00066999
EINECS: 244-665-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB648.00 | In Stock |
|
| 25g | RMB2472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-141 °C(lit.) |
| Boiling point: | 333.3±42.0 °C(Predicted) |
| Density | 1.2685 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| pka | 13.55±0.20(Predicted) |
| form | Fine Crystalline Powder |
| color | Beige |
| InChI | 1S/C12H13ClF3NO/c13-10-2-1-8(7-9(10)12(14,15)16)11(18)3-5-17-6-4-11/h1-2,7,17-18H,3-6H2 |
| InChIKey | RALRVIPTUXSBPO-UHFFFAOYSA-N |
| SMILES | OC1(CCNCC1)c2ccc(Cl)c(c2)C(F)(F)F |
| CAS DataBase Reference | 21928-50-7(CAS DataBase Reference) |
Description and Uses
4-(4-Chloro-3-(trifluoromethyl)phenyl)-4-piperidinol may be used to synthesize piperidinols and penfluridol (a neuroleptic agent).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |

![4-[4-Chloro-3-(trifluoromethyl)phenyl]-4-hydroxypiperidine](https://img.chemicalbook.com/CAS/GIF/21928-50-7.gif)




