T8467130
3-(3,4-Dihydroxyphenyl)-DL-alanine , >98.0%(T) , 63-84-3
Synonym(s):
DL -3-Hydroxytyrosine;DL -DOPA;3-(3,4-Dihydroxyphenyl)-DL -alanine
CAS NO.:63-84-3
Empirical Formula: C9H11NO4
Molecular Weight: 197.19
MDL number: MFCD00063060
EINECS: 200-566-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB144.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-272 °C(lit.) |
| Boiling point: | 334.28°C (rough estimate) |
| Density | 1.3075 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Water:62.5(Max Conc. mg/mL);316.95(Max Conc. mM) |
| pka | 2.24±0.20(Predicted) |
| form | Powder |
| color | Off-white |
| Odor | Odorless |
| Water Solubility | Soluble in water, 0.5M dilute hydrochloric acid and formic acid. Insoluble in ethanol, benzene, chloroform and ethyl acetate. |
| Merck | 14,3420 |
| BRN | 3204800 |
| InChI | 1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14) |
| InChIKey | WTDRDQBEARUVNC-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(O)=O |
| CAS DataBase Reference | 63-84-3(CAS DataBase Reference) |
Description and Uses
3,4-Dihydroxy-DL-phenylalanine is used as a dopamine precursor. It is also useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AY5250000 |
| HS Code | 2922500090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







