T8486130
2,4-Dinitrofluorobenzene , >99.0%(GC) , 70-34-8
Synonym(s):
2,4-Dinitro-1-fluorobenzene;DNFB;DNPF;FDNB;Sanger reagent
CAS NO.:70-34-8
Empirical Formula: C6H3FN2O4
Molecular Weight: 186.1
MDL number: MFCD00007056
EINECS: 200-734-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-27 °C (lit.) |
| Boiling point: | 178 °C/25 mmHg (lit.) |
| Density | 1.482 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | chloroform: 0.1 g/mL, clear |
| form | Liquid or Low Melting Crystals |
| color | Yellow to brownish |
| Specific Gravity | 1.482 |
| Water Solubility | 400 mg/L (25 ºC) |
| Merck | 14,4172 |
| BRN | 398632 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6H3FN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| InChIKey | LOTKRQAVGJMPNV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(F)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 70-34-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-fluoro-2,4-dinitro-(70-34-8) |
| EPA Substance Registry System | 2,4-Dinitrofluorobenzene (70-34-8) |
Description and Uses
1-Fluoro-2,4-dinitrobenzene is used to identify the amino acid sequence. It reacts with amino group of amino acids to yield dinitrophenyl-amino acids. It is also used in chromatographic methods. Further, it acts as an alkylating agent used in elucidating amino acid sequence in proteins.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H373 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338-P314 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | C,T,Xn |
| Risk Statements | 22-33-34-42/43-40-23/24/25-43-36/38-36/37/38 |
| Safety Statements | 22-26-36/37/39-45-28A-23-7/9-36/37 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | CZ7800000 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 STOT SE 3 |
| Hazardous Substances Data | 70-34-8(Hazardous Substances Data) |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |





