PRODUCT Properties
| Melting point: | 139-141 °C(lit.) |
| Boiling point: | 214°C 40mm |
| Density | 0.9845 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5542 (estimate) |
| Flash point: | 214°C/40mm |
| storage temp. | 2-8°C |
| Water Solubility | Insoluble in water |
| pka | 12.01±0.40(Predicted) |
| form | Solid:particulate/powder |
| color | White to Yellow to Orange |
| BRN | 2052291 |
| InChI | 1S/C15H24O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-8,16-17H,9H2,1-6H3 |
| InChIKey | HNURKXXMYARGAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CO)cc(c1O)C(C)(C)C |
| LogP | 3.16 at 20℃ |
| CAS DataBase Reference | 88-26-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Di-tert-butyl-4-hydroxybenzyl alcohol(88-26-6) |
| EPA Substance Registry System | 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenemethanol (88-26-6) |
Description and Uses
Antioxidant for gasoline and other hydrocarbons.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P273-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DO0750000 |
| TSCA | TSCA listed |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |
| Toxicity | LDLo oral in mouse: 7gm/kg |
