T8537830
(+)-N,N'-Diallyl-L-tartardiamide , >98.0%(T)(HPLC) , 58477-85-3
Synonym(s):
N,N′-Diallyl L -tartardiamide;N,N′-Diallyltartramide;DATD
CAS NO.:58477-85-3
Empirical Formula: C10H16N2O4
Molecular Weight: 228.24
MDL number: MFCD00008640
EINECS: 261-277-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-188 °C(lit.) |
| Boiling point: | 370.05°C (rough estimate) |
| alpha | +108°(20/D) (c=2.4, H2O) |
| Density | 1.2265 (rough estimate) |
| refractive index | 108 ° (C=2.4, H2O) |
| storage temp. | 2-8°C |
| solubility | soluble in Ethanol,Methanol |
| form | Fine Flakes |
| color | White to off-white |
| optical activity | [α]20/D +108°, c = 2.4 in H2O |
| BRN | 1712934 |
| InChI | 1S/C10H16N2O4/c1-3-5-11-9(15)7(13)8(14)10(16)12-6-4-2/h3-4,7-8,13-14H,1-2,5-6H2,(H,11,15)(H,12,16)/t7-,8-/m1/s1 |
| InChIKey | ZRKLEAHGBNDKHM-HTQZYQBOSA-N |
| SMILES | O[C@H]([C@@H](O)C(=O)NCC=C)C(=O)NCC=C |
| CAS DataBase Reference | 58477-85-3(CAS DataBase Reference) |
| EPA Substance Registry System | Butanediamide, 2,3-dihydroxy-N,N'-di-2-propenyl-, (2R,3R)- (58477-85-3) |
Description and Uses
Cross-linking co-monomer for the polymerization of soluble polyacrylamide gels
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |






