PRODUCT Properties
| Melting point: | 86-90 °C (lit.) |
| Boiling point: | 362.5±52.0 °C(Predicted) |
| Density | 1.57±0.1 g/cm3(Predicted) |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 1288368 |
| InChI | 1S/C7H6O4S3/c1-10-5(8)3-4(6(9)11-2)14-7(12)13-3/h1-2H3 |
| InChIKey | UZKKFHMMXWDIPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC(=S)S1)C(=O)OC |
Description and Uses
Dimethyl 2-thioxo-1,3-dithiole-4,5-dicarboxylate is a sulphur-containing heterocyclic building block. It has been reported to be formed during the reaction of 1,3-dithiolan-2-thiones with dimethyl acetylenedicarboxylate. It is formed as major product during the reaction of ethylene trithiocarbonate with dimethyl acetylenedicarboxylate.
Safety
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 2934.99.4400 |
| Storage Class | 11 - Combustible Solids |
