T8623630
Methyl 3,5-Dibromo-4-hydroxybenzoate Monohydrate , >99.0%(GC) , 41727-47-3
CAS NO.：41727-47-3
Empirical Formula: C8H6Br2O3
Molecular Weight: 309.94
MDL number: MFCD00016416
EINECS: 255-521-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-125 °C(lit.) |
| Boiling point: | 297.2±35.0 °C(Predicted) |
| Density | 1.9544 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.30±0.23(Predicted) |
| color | White to Off-White |
| Water Solubility | Slightly soluble in water. |
| BRN | 2373854 |
| InChI | InChI=1S/C8H6Br2O3/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,11H,1H3 |
| InChIKey | NVGJGYZKXBLIKY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Br)=C(O)C(Br)=C1 |
| CAS DataBase Reference | 41727-47-3(CAS DataBase Reference) |
Description and Uses
Methyl 3,5-dibromo-4-hydroxybenzoate is used to produce 4-hydroxy-3,5-di-pyridin-2-yl-benzoic acid methyl ester at temperature of 90-100°C.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29182900 |
