T8648630
6,6-Dimethylfulvene , >95.0%(GC) , 2175-91-9
Synonym(s):
5-(1-Methylethylidene)-1,3-cyclopentadiene;5-Isopropylidene-1,3-cyclopentadiene
| Pack Size | Price | Stock | Quantity |
| 1g | RMB408.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 3 °C |
| Boiling point: | 76-77 °C/50 mmHg (lit.) |
| Density | 0.881 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 43°C |
| storage temp. | -20°C |
| form | clear liquid |
| color | Light yellow to Brown |
| BRN | 1616308 |
| InChI | InChI=1S/C8H10/c1-7(2)8-5-3-4-6-8/h3-6H,1-2H3 |
| InChIKey | WXACXMWYHXOSIX-UHFFFAOYSA-N |
| SMILES | C1/C(=C(/C)\C)/C=CC=1 |
| CAS DataBase Reference | 2175-91-9(CAS DataBase Reference) |
Description and Uses
6,6-Dimethylfulvene can be used for hydrogenation of azulene synthesis; olefin protection.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H304 |
| Precautionary statements | P210-P301+P310+P331 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 10-65 |
| Safety Statements | 16-62 |
| RIDADR | UN 3295 3/PG 3 |
| WGK Germany | 3 |
| F | 4.10-10-13-23 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 2902190000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Asp. Tox. 1 Flam. Liq. 3 |






