T8651630
3',5'-Dibromo-4'-hydroxyacetophenone , >97.0%(GC) , 2887-72-1
CAS NO.：2887-72-1
Empirical Formula: C8H6Br2O2
Molecular Weight: 293.94
MDL number: MFCD00075779
EINECS: 220-750-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB400.00 | In Stock |
|
| 25g | RMB1192.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-187 °C(lit.) |
| Boiling point: | 337.7±42.0 °C(Predicted) |
| Density | 1.936±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | very faint turbidity in hot Methanol |
| form | powder to crystal |
| pka | 5.11±0.23(Predicted) |
| color | White to Almost white |
| InChI | 1S/C8H6Br2O2/c1-4(11)5-2-6(9)8(12)7(10)3-5/h2-3,12H,1H3 |
| InChIKey | ZNWPTJSBHHIXLJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Br)c(O)c(Br)c1 |
| CAS DataBase Reference | 2887-72-1(CAS DataBase Reference) |
Description and Uses
3′,5′-Dibromo-4′-hydroxyacetophenone (3,5-dibromo-4-hydroxyacetophenone) can be obtained from 4-hydroxyacetophenone, via bromination by N-bromosuccinimide in the presence of LiClO4-SiO2.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2914790090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
