PRODUCT Properties
| Melting point: | 173 °C |
| Boiling point: | 459.6±38.0 °C(Predicted) |
| Density | 1.183 |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Sonicated) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C17H14O2/c1-10(18)12-3-5-16-14(7-12)9-15-8-13(11(2)19)4-6-17(15)16/h3-8H,9H2,1-2H3 |
| InChIKey | RIRYGERFWHUZBT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(C(=O)C)=C2)C2=C1C=C(C(=O)C)C=C2 |
| CAS DataBase Reference | 961-27-3(CAS DataBase Reference) |
Description and Uses
2,7-Diacetylfluorene is used as a reactant in the synthesis of (dioxaborine)fluorene derivatives for light-emitting diodes (LEDs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2914409000 |






