PRODUCT Properties
| Melting point: | 190°C(lit.) |
| Boiling point: | 466.8±45.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 15.00±0.40(Predicted) |
| color | Light yellow to Yellow to Orange |
| Water Solubility | 53mg/L at 20℃ |
| InChI | InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,15-17,20H,2-9H2,1H3/t15-,16+,17+,18+/s3 |
| InChIKey | PUQSDJZESAQGQS-IWZYPTQDNA-N |
| SMILES | C12CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)CCC=21)O |&1:3,5,8,10,r| |
| LogP | 2.4 at 25℃ |
Description and Uses
Gestagenic Testosterone (T155000) derivative. A steroid ligand for the cytosol androgen receptor (AR) of rat prostate.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360-H351 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| HS Code | 2937.29.9050 |





