T8808330
3',5'-Dichloro-4'-hydroxyacetophenone , >98.0%(GC)(T) , 17044-70-1
CAS NO.：17044-70-1
Empirical Formula: C8H6Cl2O2
Molecular Weight: 205.04
MDL number: MFCD00016421
EINECS: 241-113-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB712.00 | In Stock |
|
| 5g | RMB2056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162.0 to 166.0 °C |
| Boiling point: | 335.5±42.0 °C(Predicted) |
| Density | 1.430±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.24±0.23(Predicted) |
| color | White to Light yellow to Light red |
| InChI | 1S/C8H6Cl2O2/c1-4(11)5-2-6(9)8(12)7(10)3-5/h2-3,12H,1H3 |
| InChIKey | FXSIZYWHUQEXPC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)c(O)c(Cl)c1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36-38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HS Code | 2914.79.4000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
