T8855530
Ethyl Phosphate (Mono- and Di- Ester mixture) , 37203-76-2
CAS NO.：37203-76-2
Empirical Formula: C6H18O8P2
Molecular Weight: 280.15
MDL number: MFCD00136002
EINECS: 253-391-7
| Pack Size | Price | Stock | Quantity |
| 25mL | RMB236.00 | In Stock |
|
| 500mL | RMB748.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 225℃ at 101.3kPa |
| Density | 1,27 g/cm3 |
| vapor pressure | 11-51000Pa at 20-163℃ |
| refractive index | 1.4200-1.4240 |
| Flash point: | 193 °C |
| Water Solubility | Completely soluble in water |
| form | Liquid:viscous |
| color | Colorless to Light yellow |
| InChI | 1S/C4H11O4P.C2H7O4P/c1-3-7-9(5,6)8-4-2;1-2-6-7(3,4)5/h3-4H2,1-2H3,(H,5,6);2H2,1H3,(H2,3,4,5) |
| InChIKey | HVBMYHDTXIDFKE-UHFFFAOYSA-N |
| SMILES | CCOP(O)(O)=O.CCOP(O)(=O)OCC |
| LogP | -0.14-0.32 at 20℃ |
| Surface tension | 62.7mN/m at 996mg/L and 20℃ |
| CAS DataBase Reference | 37203-76-2 |
| EPA Substance Registry System | Ethyl phosphate (37203-76-2) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P260-P264-P270-P271-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 1760 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2919.90.5050 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
