T8869030
1-(2-Ethoxyphenyl)piperazine Hydrochloride , >98.0%(T)(HPLC) , 83081-75-8
CAS NO.：83081-75-8
Empirical Formula: C12H19ClN2O
Molecular Weight: 242.75
MDL number: MFCD00012763
EINECS: 280-190-1
| Pack Size | Price | Stock | Quantity |
| 25g | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 207-209 °C(lit.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C12H18N2O.ClH/c1-2-15-12-6-4-3-5-11(12)14-9-7-13-8-10-14;/h3-6,13H,2,7-10H2,1H3;1H |
| InChIKey | OPDWQXGKXOCCDT-UHFFFAOYSA-N |
| SMILES | Cl[H].CCOc1ccccc1N2CCNCC2 |
| CAS DataBase Reference | 83081-75-8(CAS DataBase Reference) |
Description and Uses
1-(2-Ethoxyphenyl)piperazine monohydrochloride may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HS Code | 2933.59.9500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
