T8920330
Ethyl 4-Quinazolone-2-carboxylate , >98.0%(T)(HPLC) , 29113-33-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB500.00 | In Stock |
|
| 5g | RMB1676.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-193 °C (lit.) |
| Boiling point: | 363.7±25.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -2.12±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 297nm(MeOH)(lit.) |
| BRN | 190186 |
| InChI | InChI=1S/C11H10N2O3/c1-2-16-11(15)9-12-8-6-4-3-5-7(8)10(14)13-9/h3-6H,2H2,1H3,(H,12,13,14) |
| InChIKey | BMCAWNQKVVTNFP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(=O)NC=1C(OCC)=O |
| CAS DataBase Reference | 29113-33-5(CAS DataBase Reference) |
Description and Uses
Ethyl 4-quinazolone-2-carboxylate may be used to synthesize 4-quinazolone-2-carboxylic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |






