A6153412
N-Benzylglycine ethyl ester , 97% , 6436-90-4
Synonym(s):
Ethyl (benzylamino)acetate
CAS NO.：6436-90-4
Empirical Formula: C11H15NO2
Molecular Weight: 193.24
MDL number: MFCD00009174
EINECS: 229-218-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB65.60 | In Stock |
|
| 100G | RMB189.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140-142 °C/10 mmHg (lit.) |
| Density | 1.031 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | 6.84±0.20(Predicted) |
| color | Clear colorless to light yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2104816 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)9-12-8-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3 |
| InChIKey | ULOLIZHBYWAICY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CNCC1=CC=CC=C1 |
| CAS DataBase Reference | 6436-90-4(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Benzylglycine ethyl ester(6436-90-4) |
Description and Uses
N-Benzylglycine ethyl ester is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff field.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 23-24/25-45-36/37/39-26-36 |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| HS Code | 29224999 |
