PRODUCT Properties
| Melting point: | 255 °C (dec.) (lit.) |
| Water Solubility | Soluble in water |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| Colour Index | 42085 |
| form | solid |
| color | Red to Dark blue to Black |
| λmax | 618 nm |
| Merck | 14,4575 |
| Stability: | Hygroscopic |
| InChIKey | XKTMIJODWOEBKO-UHFFFAOYSA-M |
| SMILES | [Na+].CCN(Cc1cccc(c1)S([O-])(=O)=O)c2ccc(cc2)\C(c3ccccc3)=C4\C=CC(\C=C4)=[N+](/CC)Cc5cccc(c5)S([O-])(=O)=O |
| CAS DataBase Reference | 4680-78-8 |
| IARC | 3 (Vol. 16, Sup 7) 1987 |
| EPA Substance Registry System | C.I. Acid Green 3 (4680-78-8) |
Description and Uses
Limited use as a dye for silk and wool fabrics; as biological stain.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | BQ4375000 |
| TSCA | TSCA listed |
| HS Code | 3204.12.5090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazardous Substances Data | 4680-78-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >2 g/kg (Lu, Lavalle) |





