PRODUCT Properties
| Melting point: | 295-297 °C (lit.) |
| Boiling point: | 498.3±40.0 °C(Predicted) |
| Density | 2.386±0.06 g/cm3(Predicted) |
| storage temp. | RT, stored under nitrogen |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C12H12Br6/c13-1-7-8(2-14)10(4-16)12(6-18)11(5-17)9(7)3-15/h1-6H2 |
| InChIKey | XJOUCILNLRXRTF-UHFFFAOYSA-N |
| SMILES | BrCc1c(CBr)c(CBr)c(CBr)c(CBr)c1CBr |
| CAS DataBase Reference | 3095-73-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2903.99.8001 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |







