A8035012
2,4,6-<WBR>Tris(bromomethyl)<WBR>mesitylene , 97% , 21988-87-4
CAS NO.：21988-87-4
Empirical Formula: C12H15Br3
Molecular Weight: 398.96
MDL number: MFCD00192554
EINECS: 244-697-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB119.20 | In Stock |
|
| 25g | RMB477.60 | In Stock |
|
| 100g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-189 °C (lit.) |
| Boiling point: | 399.8±37.0 °C(Predicted) |
| Density | 1.759±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C12H15Br3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h4-6H2,1-3H3 |
| InChIKey | BHIFXIATEXVOQA-UHFFFAOYSA-N |
| SMILES | C1(CBr)=C(C)C(CBr)=C(C)C(CBr)=C1C |
| CAS DataBase Reference | 21988-87-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,Xi |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 22-26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2903998090 |
