PRODUCT Properties
| Melting point: | 83-85 °C (lit.) |
| Boiling point: | 312.08°C (rough estimate) |
| Density | 1.1035 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| pka | 8.24±0.43(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | 1S/C14H12O2/c1-10-7-8-13(15)12(9-10)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3 |
| InChIKey | OQERFUGURPLBQH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(c1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 1470-57-1(CAS DataBase Reference) |
Description and Uses
2-?Hydroxy-?5-?methylbenzophenone is a general reagent used in the synthesis of anti-bacterial and anti-fungal agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
