PRODUCT Properties
| Melting point: | 220-222 °C (dec.) (lit.) |
| Boiling point: | 464.3±45.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| pka | 9.53±0.40(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 87354 |
| InChI | 1S/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| InChIKey | XYHWPQUEOOBIOW-UHFFFAOYSA-N |
| SMILES | Oc1ccc2OC(CC(=O)c2c1)c3ccccc3 |
| LogP | 2.955 (est) |
| CAS DataBase Reference | 4250-77-5(CAS DataBase Reference) |
Description and Uses
6-Hydroxyflavanone (6-HF) has been used for the enantiomeric separation of flavonoids using polysaccharide-based chiral stationary phases by nano-liquid chromatography (nano-LC). Racemic 6-HF may be used in the synthesis of 6-propionoxy-flavanone (6-PF). 6-HF may be employed as synthetic flavone to investigate the mechanism of tumor necrosis factor-related apoptosis-inducing ligand (TRAIL) induced cytotoxic and apoptotic effects in HeLa cancer cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29329900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
