PRODUCT Properties
| Melting point: | 97-100 °C(lit.) |
| Boiling point: | 315.1±22.0 °C(Predicted) |
| Density | 1.244±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | White to Yellow to Green |
| BRN | 646069 |
| InChI | 1S/C9H9NO4/c1-6(11)7-3-4-9(14-2)8(5-7)10(12)13/h3-5H,1-2H3 |
| InChIKey | VXLKYQQBEPCMJE-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1[N+]([O-])=O)C(C)=O |
| CAS DataBase Reference | 6277-38-9(CAS DataBase Reference) |
Description and Uses
4′-Methoxy-3′-nitroacetophenone may be used to synthesize dimethylamino compound, via W2 Raney nickel catalyzed reductive methylation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |






