T9523130
3-(4-Methoxyphenyl)pyrazole-4-carboxaldehyde , >98.0%(GC) , 199682-73-0
CAS NO.：199682-73-0
Empirical Formula: C11H10N2O2
Molecular Weight: 202.21
MDL number: MFCD01133696
EINECS: 633-748-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB472.00 | In Stock |
|
| 5g | RMB1592.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160 °C |
| Boiling point: | 449.2±40.0 °C(Predicted) |
| Density | 1.248±0.06 g/cm3(Predicted) |
| pka | 11.25±0.50(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Air Sensitive |
| InChI | 1S/C11H10N2O2/c1-15-10-4-2-8(3-5-10)11-9(7-14)6-12-13-11/h2-7H,1H3,(H,12,13) |
| InChIKey | QSGGFCPKXTULQQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)-c2n[nH]cc2C=O |
| CAS DataBase Reference | 199682-73-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
