PRODUCT Properties
| Melting point: | >300℃ |
| form | powder to crystal |
| color | White |
| InChI | InChI=1S/C6H5NO2.Na.H/c8-6(9)5-2-1-3-7-4-5;;/h1-4H,(H,8,9);; |
| InChIKey | VKASAVRWDBEMDN-UHFFFAOYSA-N |
| SMILES | C(C1=CN=CC=C1)(=O)O.[NaH] |
| CAS DataBase Reference | 54-86-4(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium nicotinate (54-86-4) |
Description and Uses
Sodium nicotinate is an intermediate for the cosmetic and the pharmaceutical industry. Product Data Sheet
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | QT2060000 |
| TSCA | TSCA listed |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
