PRODUCT Properties
| Melting point: | 221-223 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water and in ethanol (96 per cent). Aqueous solutions are slightly acid; the base may be precipitated when the solutions are allowed to stand. |
| form | Solid |
| color | Crystals |
| Merck | 13,6752 |
| InChIKey | MFLVZFXCSKVCSH-FSKSRBAZNA-N |
| SMILES | C12=C(CCN(C)[C@@]1([H])[C@@]1([H])OC(=O)C3C(OC)=C(OC)C=CC1=3)C=C1OCOC1=C2OC.Cl |&1:6,8,r| |
| EPA Substance Registry System | 1(3H)-Isobenzofuranone, 6,7-dimethoxy-3-[(5R)-5,6,7,8-tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-, hydrochloride, (3S)- (912-60-7) |
Description and Uses
Anti-Tussive
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H336 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | NP7225000 |
| F | 10 |
| HS Code | 2939.19.5000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Toxicity | cyt-ham:fbr 60 mg/L ESKHA5 96,55,78 |
