PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 4169554 |
| InChI | 1S/C14H22O3S.Na/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)18(15,16)17;/h9-12H,2-8H2,1H3,(H,15,16,17);/q;+1/p-1 |
| InChIKey | ASJUTVUXOMPOQH-UHFFFAOYSA-M |
| SMILES | [Na+].CCCCCCCCc1ccc(cc1)S([O-])(=O)=O |
| CAS DataBase Reference | 6149-03-7 |
Description and Uses
4-Octylbenzenesulfonic Acid Sodium Salt can be used as a disinfectant with high antibacterial activity and stability.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2904.10.3700 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
