PRODUCT Properties
| Boiling point: | 157-164 °C(Press: 0.3 Torr) |
| Density | 0.89 |
| refractive index | 1.4480 to 1.4520 |
| Flash point: | 194 °C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C24H51O3P/c1-7-13-16-22(10-4)19-25-28(26-20-23(11-5)17-14-8-2)27-21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3 |
| InChIKey | ILLOBGFGKYTZRO-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COP(OCC(CC)CCCC)OCC(CC)CCCC |
| CAS DataBase Reference | 301-13-3 |
| EPA Substance Registry System | Tris(2-ethylhexyl) phosphite (301-13-3) |
Description and Uses
Synthesis, plasticizers, stabilizers, lubricant and grease additives, flameproofing compositions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| RTECS | TH2090000 |
| TSCA | TSCA listed |
| HS Code | 2920.90.5100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
| Toxicity | LD50 oral in rabbit: 8500mg/kg |
