PRODUCT Properties
| Melting point: | 172-174 °C(lit.) |
| Boiling point: | 325.66°C (rough estimate) |
| Density | 1.198 |
| refractive index | 1.6530 (estimate) |
| pka | 4.8 in 60% ethanol |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,7281 |
| BRN | 1911342 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/b14-11+ |
| InChIKey | BIDDLDNGQCUOJQ-SDNWHVSQSA-N |
| SMILES | OC(=O)\C(=C\c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 91-48-5(CAS DataBase Reference) |
Description and Uses
α-Phenylcinnamic Acid, is a 2,3-Diarylpropenoic Acid, which is a selective non-steroidal inhibitors of type-5 17β-hydroxysteroid dehydrogenase (AKR1C3).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 13 - Non Combustible Solids |






