PRODUCT Properties
| Melting point: | 96-98°C |
| Boiling point: | 277.3±33.0℃ (760 Torr) |
| Density | 1.155±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 121.5±25.4℃ |
| storage temp. | Storage temp. 2-8°C |
| pka | 13.10±0.29(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Slightly Soluble in water (1.8 g/L) (25°C). |
| InChI | InChI=1S/C8H9NS/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | CJXBHFANXQMZBF-UHFFFAOYSA-N |
| SMILES | C1(CC(N)=S)=CC=CC=C1 |
Description and Uses
2-Phenylthioacetamide find extensive use in organic synthesis. N-bromo and N-chloro succinimides are halogenating agents. Phthalimides are used in the synthesis of primary amines.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2924190090 |
