T9904730
N-Succinimidyl 5-Azido-2-nitrobenzoate , >97.0%(HPLC) , 60117-35-3
Synonym(s):
N-(5-Azido-2-nitrobenzoyloxy)succinimide;N-Succinimidyl 5-azido-2-nitrobenzoate
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133°C |
| storage temp. | 2-8°C |
| solubility | ethyl acetate: 25 mg/mL |
| form | powder |
| color | yellow |
| BRN | 1555224 |
| InChI | 1S/C11H7N5O6/c12-14-13-6-1-2-8(16(20)21)7(5-6)11(19)22-15-9(17)3-4-10(15)18/h1-2,5H,3-4H2 |
| InChIKey | FUOJEDZPVVDXHI-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(CCC1=O)=O)C2=C(C=CC(N=[N+]=[N-])=C2)[N+]([O-])=O |
Description and Uses
ANB-NOS Crosslinker contains a nitrophenyl azide group and an amine reactive NHS ester group. It is also able to react with nucleophiles.
Anb-Nos Crosslinker can be used for devices implanted in the eyes to treat glaucoma and/or dry eye.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-8-10 |
| HS Code | 29299090 |
| Storage Class | 11 - Combustible Solids |






