PRODUCT Properties
| Melting point: | 189-190° |
| alpha | D20 -89.9° (water) |
| Boiling point: | 574.7±50.0 °C(Predicted) |
| Density | 1.481±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| pka | 12.78±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Odor | at 100.00 %. very mild vanilla |
| Odor Type | vanilla |
| Stability: | Hygroscopic |
| Major Application | food and beverages pharmaceutical |
| InChIKey | LPRNQMUKVDHCFX-RKQHYHRCSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)Oc2c(cc(cc2)C=O)OC |
| LogP | -1.252 (est) |
Description and Uses
Vanillin 4-O-β-D-Glucoside is the glucosylated precursor of Vanillin (V097500) found in the seed pods of Vanilla planifola. During the curing process Vanillin 4-O-β-D-Glucoside is transformed into the aromatic vanillin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P330-P302+P352-P321-P304+P340-P305+P351+P338-P332+P313-P362+P364-P337+P313-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |



![1,3,4,6-Tetra-O-acetyl-2-deoxy-2-[(2-azidoacetyl)amino]-β-D-glucopyranose](https://img.chemicalbook.com/CAS/20211123/GIF/857677-98-6.gif)


