PRODUCT Properties
| Melting point: | 4-5 °C (lit.) |
| Boiling point: | 221-222 °C (lit.) |
| Density | 2.188 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 2.188 |
| BRN | 107642 |
| InChI | InChI=1S/C4H2Br2S/c5-3-1-7-2-4(3)6/h1-2H |
| InChIKey | VGKLVWTVCUDISO-UHFFFAOYSA-N |
| SMILES | C1SC=C(Br)C=1Br |
| CAS DataBase Reference | 3141-26-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Thiophene, 3,4-dibromo-(3141-26-2) |
Description and Uses
3,4-Dibromothiphene is used in the synthesis of thiophene-estrogen receptor ligands which contain superagonist activities when involving luciferase in genes in human cells giving 2-3 times the activit y of estradiol. Also used in the synthesis of supercapacitors for use as charge storage applications.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





