A0605612
1-Acetyl-4-(4-hydroxyphenyl)piperazine , 98% , 67914-60-7
CAS NO.:67914-60-7
Empirical Formula: C12H16N2O2
Molecular Weight: 220.27
MDL number: MFCD00044905
EINECS: 267-744-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB196.80 | In Stock |
|
| 500G | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-185 °C (lit.) |
| Boiling point: | 361.21°C (rough estimate) |
| Density | 1.1115 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.6000 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 12.18±0.30(Predicted) |
| color | White to slightly pink or beige |
| Water Solubility | 4.3 g/L (20 ºC) |
| BRN | 795777 |
| InChI | 1S/C12H16N2O2/c1-10(15)13-6-8-14(9-7-13)11-2-4-12(16)5-3-11/h2-5,16H,6-9H2,1H3 |
| InChIKey | AGVNLFCRZULMKK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)c2ccc(O)cc2 |
| LogP | 0.3 |
| CAS DataBase Reference | 67914-60-7(CAS DataBase Reference) |
Description and Uses
1-Acetyl-4-(4-hydroxyphenyl)piperazine may be used in the preparation of 1-acetyl-4-(4-octadecyloxyphenyl)piperazine. It may also be used in the multi-step synthesis of ketoconazole, its 1,2,4-triazole and thiazole analogs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| HS Code | 29214910 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







