A0609812
4-Amino-3-nitrophenol , 98% , 610-81-1
Synonym(s):
4-Hydroxy-2-nitroaniline
CAS NO.：610-81-1
Empirical Formula: C6H6N2O3
Molecular Weight: 154.12
MDL number: MFCD00066310
EINECS: 210-236-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-154 °C(lit.) |
| Boiling point: | 322.46°C (rough estimate) |
| Density | 1.3617 (estimate) |
| refractive index | 1.6890 (rough estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 9.21±0.10(Predicted) |
| color | deep violet |
| Water Solubility | soluble |
| BRN | 2210196 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H6N2O3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H,7H2 |
| InChIKey | IQXUIDYRTHQTET-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N)C([N+]([O-])=O)=C1 |
| LogP | 1.320 (est) |
| CAS DataBase Reference | 610-81-1(CAS DataBase Reference) |
Description and Uses
4-Amino-3-nitrophenol is an aminonitrophenol isomer used in hair dyes, potent human skin sensitizers and other cosmetic products with very low levels of mutagenic activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H302-H312 |
| Precautionary statements | P280h-P305+P351+P338-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| PackingGroup | III |
| HS Code | 29222900 |
