A0609912
(+)-6-Aminopenicillanic acid , 98% , 551-16-6
Synonym(s):
(+)-6-Aminopenicillanic acid;(2S,5R,6R)-6-Amino-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;6-aminopenicillanic acid;6-APA
CAS NO.:551-16-6
Empirical Formula: C8H12N2O3S
Molecular Weight: 216.26
MDL number: MFCD00005176
EINECS: 208-993-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB168.00 | In Stock |
|
| 500g | RMB405.60 | In Stock |
|
| 2.5KG | RMB1428.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-200 °C (dec.)(lit.) |
| Boiling point: | 460.2±45.0 °C(Predicted) |
| alpha | 276.3 º (c=1.2, 0.1N HCl 22 ºC) |
| Density | 1.3418 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | 2-8°C |
| solubility | 2.46g/l |
| form | Fine Powder |
| pka | pKa 2.3 (Uncertain) |
| color | White to cream |
| PH | 3.4 (100g/l, H2O) |
| optical activity | [α]22/D +276.3°, c = 1.2 in 0.1 M HCl |
| Water Solubility | Soluble in water and hydrochoric acid. |
| Merck | 14,458 |
| BRN | 15080 |
| Stability: | Light sensitive |
| InChI | 1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/t3-,4+,6-/m1/s1 |
| InChIKey | NGHVIOIJCVXTGV-SDKNWNMFSA-N |
| SMILES | CC1(C)S[C@@H]2[C@H](N)C(=O)N2[C@H]1C(O)=O |
| LogP | -3.87 at 22.5℃ |
| CAS DataBase Reference | 551-16-6(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Aminopenicillanic acid (551-16-6) |
Description and Uses
6-Aminopenicillanic acid is the basic unit in penicillins, which is obtained from the fermentation brew of the Penicillium mold. It acts as a starting material for the preparation of many semisynthetic penicillins. Further, it serves as apharmaceutical intermediate. In addition to this, it is used in antibiotics research and experimental application.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 22-36/37-45-37-24-36 |
| WGK Germany | 2 |
| RTECS | XH8225000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |







