PRODUCT Properties
| Melting point: | 221 °C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow |
| BRN | 806524 |
| InChI | InChI=1S/C11H7Cl2NO3/c1-5-8(11(15)16)10(14-17-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H,15,16) |
| InChIKey | WQXUUMUOERZZAE-UHFFFAOYSA-N |
| SMILES | O1C(C)=C(C(O)=O)C(C2=C(Cl)C=CC=C2Cl)=N1 |
| CAS DataBase Reference | 3919-76-4(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Isoxazolecarboxylic acid, 3-(2,6-dichlorophenyl)-5-methyl- (3919-76-4) |
Description and Uses
3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid is used in the preparation of isoxazolyl penicillin derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-36/37-36/37/39-26 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HS Code | 2935909550 |






