M2084435
DicloxacillinSodiumhydrate , ≥98% , 13412-64-1
Synonym(s):
Dicloxacillin sodium salt monohydrate
CAS NO.:13412-64-1
Empirical Formula: C19H16Cl2N3NaO5S·H2O
Molecular Weight: 510.32
MDL number: MFCD00210902
EINECS: 603-794-2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB337.60 | In Stock |
|
| 250mg | RMB745.60 | In Stock |
|
| 1g | RMB2176.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-225°C |
| alpha | D20 +127.2° (water) |
| storage temp. | 2-8°C |
| solubility | H2O: soluble50mg/mL |
| form | powder |
| color | white to off-white |
| Water Solubility | Soluble in water |
| BRN | 4778711 |
| Stability: | Hygroscopic |
| Major Application | clinical testing |
| InChIKey | SIGZQNJITOWQEF-VICXVTCVSA-M |
| SMILES | [Na+].[H]O[H].Cc1onc(c1C(=O)N[C@H]2[C@H]3SC(C)(C)[C@@H](N3C2=O)C([O-])=O)-c4c(Cl)cccc4Cl |
| CAS DataBase Reference | 13412-64-1(CAS DataBase Reference) |
Description and Uses
Antibacterial;Bacterial transpeptidase inhibitor
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H334-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 22-26-36/37-45 |
| WGK Germany | 2 |
| RTECS | XH8925000 |
| HS Code | 29411099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 in mice (g/kg): 0.9 i.v.; in rats (g/kg): 0.63 i.p.; >5 orally (Gloxhuber) |







