A0611712
2-Amino-6-chloropyridine , 97% , 45644-21-1
Synonym(s):
6-Chloro-2-pyridinamine
CAS NO.:45644-21-1
Empirical Formula: C5H5ClN2
Molecular Weight: 128.56
MDL number: MFCD00234068
EINECS: 629-259-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 100G | RMB289.60 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-73 °C |
| Boiling point: | 255.7±20.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.76±0.24(Predicted) |
| form | Powder or Low Melting Solid |
| color | Orange to light brown |
| BRN | 108669 |
| InChI | InChI=1S/C5H5ClN2/c6-4-2-1-3-5(7)8-4/h1-3H,(H2,7,8) |
| InChIKey | OBYJTLDIQBWBHM-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(Cl)=CC=C1 |
| CAS DataBase Reference | 45644-21-1(CAS DataBase Reference) |
Description and Uses
Substrate used in a Ni(II)-catalyzed homo-coupling providing diamino-2,2′-bipyridine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H332-H302-H315-H319-H335 |
| Precautionary statements | P280h-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37-36 |
| WGK Germany | 3 |
| RTECS | US1813350 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







