A0798612
2-Amino-3-chloropyridine , ≥98.0%(GC) , 39620-04-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB20.00 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB36.00 | In Stock |
|
| 25g | RMB113.60 | In Stock |
|
| 100g | RMB384.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-62℃ |
| Boiling point: | 207.0±20.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 4.14±0.36(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C5H5ClN2/c6-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8) |
| InChIKey | RZJPBQGRCNJYBU-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1Cl |
| CAS DataBase Reference | 39620-04-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22-20/21/22 |
| Safety Statements | 26-36/37/39-39-36/37-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








