A0654912
2-Amino-4-chloropyridine , 97% , 19798-80-2
Synonym(s):
4-Chloro-2-pyridinamine
CAS NO.：19798-80-2
Empirical Formula: C5H5ClN2
Molecular Weight: 128.56
MDL number: MFCD04113820
EINECS: 629-610-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB68.80 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-127°C |
| Boiling point: | 240.8±20.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Liquid |
| pka | 5.72±0.11(Predicted) |
| color | Colorless to yellow to brown |
| λmax | 294nm(CHCl3)(lit.) |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/C5H5ClN2/c6-4-1-2-8-5(7)3-4/h1-3H,(H2,7,8) |
| InChIKey | RQMWVVBHJMUJNZ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 19798-80-2(CAS DataBase Reference) |
Description and Uses
2-Amino-4-chloropyridine is a useful precursor that could be used to synthesize 2-amino-4,5-dichloropyridine, 2-amino-3,4-dichloropyridine, and 2-amino-3,4,5-trichloropyridine[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
