A0612912
4-Amino-6-chloropyrimidine , 98% , 5305-59-9
Synonym(s):
6-Amino-4-chloropyrimidine
CAS NO.:5305-59-9
Empirical Formula: C4H4ClN3
Molecular Weight: 129.55
MDL number: MFCD00053576
EINECS: 664-284-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250mg | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25g | RMB80.00 | In Stock |
|
| 100g | RMB268.80 | In Stock |
|
| 500g | RMB996.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-216°C |
| Boiling point: | 289.0±20.0 °C(Predicted) |
| Density | 1.437±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO |
| pka | 2.16±0.10(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C4H4ClN3/c5-3-1-4(6)8-2-7-3/h1-2H,(H2,6,7,8) |
| InChIKey | DUKKRSPKJMHASP-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC(N)=N1 |
| CAS DataBase Reference | 5305-59-9(CAS DataBase Reference) |
Description and Uses
4-Amino-6-chloropyrimidine is an intermediate of sulfa-6-methoxypyrimidine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






